About N-[(4-butoxy-1,3-benzothiazol-2-yl)sulfanyl]cyclohexanamine
N-[(4-butoxy-1,3-benzothiazol-2-yl)sulfanyl]cyclohexanamine (PubChem CID 18327019) has the molecular formula C17H24N2OS2
and a molecular weight of 336.53 g/mol. Its IUPAC name is N-[(4-butoxy-1,3-benzothiazol-2-yl)sulfanyl]cyclohexanamine.
Molecular Properties
| Compound Name | N-[(4-butoxy-1,3-benzothiazol-2-yl)sulfanyl]cyclohexanamine |
| PubChem CID | 18327019 |
| Molecular Formula | C17H24N2OS2 |
| Molecular Weight | 336.53 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-[(4-butoxy-1,3-benzothiazol-2-yl)sulfanyl]cyclohexanamine |
| SMILES | CCCCOc1cccc2sc(SNC3CCCCC3)nc12 |
| InChI | InChI=1S/C17H24N2OS2/c1-2-3-12-20-14-10-7-11-15-16(14)18-17(21-15)22-19-13-8-5-4-6-9-13/h7,10-11,13,19H,2-6,8-9,12H2,1H3 |
| InChIKey | WQWFPERDSCKCQE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-butoxy-1,3-benzothiazol-2-yl)sulfanyl]cyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-butoxy-1,3-benzothiazol-2-yl)sulfanyl]cyclohexanamine?
The IUPAC name of N-[(4-butoxy-1,3-benzothiazol-2-yl)sulfanyl]cyclohexanamine (CID 18327019) is N-[(4-butoxy-1,3-benzothiazol-2-yl)sulfanyl]cyclohexanamine.
What is the SMILES notation for N-[(4-butoxy-1,3-benzothiazol-2-yl)sulfanyl]cyclohexanamine?
The canonical SMILES for N-[(4-butoxy-1,3-benzothiazol-2-yl)sulfanyl]cyclohexanamine is CCCCOc1cccc2sc(SNC3CCCCC3)nc12.
What is the InChIKey of N-[(4-butoxy-1,3-benzothiazol-2-yl)sulfanyl]cyclohexanamine?
The InChIKey is WQWFPERDSCKCQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2OS2/c1-2-3-12-20-14-10-7-11-15-16(14)18-17(21-15)22-19-13-8-5-4-6-9-13/h7,10-11,13,19H,2-6,8-9,12H2,1H3.
What are the key properties of N-[(4-butoxy-1,3-benzothiazol-2-yl)sulfanyl]cyclohexanamine?
N-[(4-butoxy-1,3-benzothiazol-2-yl)sulfanyl]cyclohexanamine has a molecular weight of 336.53 g/mol, XLogP of 5.40, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-butoxy-1,3-benzothiazol-2-yl)sulfanyl]cyclohexanamine is sourced from PubChem (CID 18327019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).