C26H27NO5S — CID 18327206
(2,5-dioxo-3,4-diphenylpyrrol-1-yl) (7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methanesulfonate (PubChem CID 18327206) has the molecular formula C26H27NO5S and a molecular weight of 465.57 g/mol. Its IUPAC name is (2,5-dioxo-3,4-diphenylpyrrol-1-yl) (7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methanesulfonate.
| Compound Name | (2,5-dioxo-3,4-diphenylpyrrol-1-yl) (7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
|---|---|
| PubChem CID | 18327206 |
| Molecular Formula | C26H27NO5S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | (2,5-dioxo-3,4-diphenylpyrrol-1-yl) (7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)ON1C(=O)C(c3ccccc3)=C(c3ccccc3)C1=O)CC2 |
| InChI | InChI=1S/C26H27NO5S/c1-25(2)20-13-15-26(25,16-14-20)17-33(30,31)32-27-23(28)21(18-9-5-3-6-10-18)22(24(27)29)19-11-7-4-8-12-19/h3-12,20H,13-17H2,1-2H3 |
| InChIKey | BRQZQYBCVQDVLE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|