C13H21N — CID 18327235
N,N,2,3,4,5,6-heptamethylaniline (PubChem CID 18327235) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is N,N,2,3,4,5,6-heptamethylaniline.
| Compound Name | N,N,2,3,4,5,6-heptamethylaniline |
|---|---|
| PubChem CID | 18327235 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | N,N,2,3,4,5,6-heptamethylaniline |
| SMILES | Cc1c(C)c(C)c(N(C)C)c(C)c1C |
| InChI | InChI=1S/C13H21N/c1-8-9(2)11(4)13(14(6)7)12(5)10(8)3/h1-7H3 |
| InChIKey | ATGDSZDNPBRLNP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |