C11H17N — CID 18327246
N,N,3,4,5-pentamethylaniline (PubChem CID 18327246) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is N,N,3,4,5-pentamethylaniline.
| Compound Name | N,N,3,4,5-pentamethylaniline |
|---|---|
| PubChem CID | 18327246 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | N,N,3,4,5-pentamethylaniline |
| SMILES | Cc1cc(N(C)C)cc(C)c1C |
| InChI | InChI=1S/C11H17N/c1-8-6-11(12(4)5)7-9(2)10(8)3/h6-7H,1-5H3 |
| InChIKey | QLRXZUGGMVJUJU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |