About 3-carbamimidoylbenzamide
3-carbamimidoylbenzamide (PubChem CID 18327622) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 3-carbamimidoylbenzamide.
Molecular Properties
| Compound Name | 3-carbamimidoylbenzamide |
| PubChem CID | 18327622 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 3-carbamimidoylbenzamide |
| SMILES | [H]/N=C(\N)c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C8H9N3O/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4H,(H3,9,10)(H2,11,12) |
| InChIKey | NVGVCXVDUGJSDE-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 92.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-carbamimidoylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-carbamimidoylbenzamide?
The IUPAC name of 3-carbamimidoylbenzamide (CID 18327622) is 3-carbamimidoylbenzamide.
What is the SMILES notation for 3-carbamimidoylbenzamide?
The canonical SMILES for 3-carbamimidoylbenzamide is [H]/N=C(\N)c1cccc(C(N)=O)c1.
What is the InChIKey of 3-carbamimidoylbenzamide?
The InChIKey is NVGVCXVDUGJSDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4H,(H3,9,10)(H2,11,12).
What are the key properties of 3-carbamimidoylbenzamide?
3-carbamimidoylbenzamide has a molecular weight of 163.18 g/mol, XLogP of 0.07, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-carbamimidoylbenzamide is sourced from PubChem (CID 18327622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).