C24H28FN3O2 — CID 18327976
7-fluoro-3-methyl-4-[4-(4-pyridin-2-ylpiperidin-1-yl)butyl]-1,4-benzoxazepin-5-one (PubChem CID 18327976) has the molecular formula C24H28FN3O2 and a molecular weight of 409.51 g/mol. Its IUPAC name is 7-fluoro-3-methyl-4-[4-(4-pyridin-2-ylpiperidin-1-yl)butyl]-1,4-benzoxazepin-5-one.
| Compound Name | 7-fluoro-3-methyl-4-[4-(4-pyridin-2-ylpiperidin-1-yl)butyl]-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 18327976 |
| Molecular Formula | C24H28FN3O2 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 7-fluoro-3-methyl-4-[4-(4-pyridin-2-ylpiperidin-1-yl)butyl]-1,4-benzoxazepin-5-one |
| SMILES | CC1=COc2ccc(F)cc2C(=O)N1CCCCN1CCC(c2ccccn2)CC1 |
| InChI | InChI=1S/C24H28FN3O2/c1-18-17-30-23-8-7-20(25)16-21(23)24(29)28(18)13-5-4-12-27-14-9-19(10-15-27)22-6-2-3-11-26-22/h2-3,6-8,11,16-17,19H,4-5,9-10,12-15H2,1H3 |
| InChIKey | JERFDRBOFHOXQA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|