About 4-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)pyrimidine
4-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)pyrimidine (PubChem CID 18328014) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 4-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)pyrimidine.
Analyze 4-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)pyrimidine?
The IUPAC name of 4-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)pyrimidine (CID 18328014) is 4-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)pyrimidine.
What is the SMILES notation for 4-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)pyrimidine?
The canonical SMILES for 4-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)pyrimidine is Cc1ccnc(C2=CCNCC2)n1.
What is the InChIKey of 4-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)pyrimidine?
The InChIKey is SKAGPAYGANVNSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-8-2-7-12-10(13-8)9-3-5-11-6-4-9/h2-3,7,11H,4-6H2,1H3.
What are the key properties of 4-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)pyrimidine?
4-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)pyrimidine has a molecular weight of 175.23 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(1,2,3,6-tetrahydropyridin-4-yl)pyrimidine is sourced from PubChem (CID 18328014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).