C18H6F10N2 — CID 18328537
1-N,2-N-bis(2,3,4,5,6-pentafluorophenyl)benzene-1,2-diamine (PubChem CID 18328537) has the molecular formula C18H6F10N2 and a molecular weight of 440.24 g/mol. Its IUPAC name is 1-N,2-N-bis(2,3,4,5,6-pentafluorophenyl)benzene-1,2-diamine.
| Compound Name | 1-N,2-N-bis(2,3,4,5,6-pentafluorophenyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 18328537 |
| Molecular Formula | C18H6F10N2 |
| Molecular Weight | 440.24 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 1-N,2-N-bis(2,3,4,5,6-pentafluorophenyl)benzene-1,2-diamine |
| SMILES | Fc1c(F)c(F)c(Nc2ccccc2Nc2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C18H6F10N2/c19-7-9(21)13(25)17(14(26)10(7)22)29-5-3-1-2-4-6(5)30-18-15(27)11(23)8(20)12(24)16(18)28/h1-4,29-30H |
| InChIKey | MVONRBBJTUSWOC-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.24 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|