About 2-cyclobutylpyrimidine
2-cyclobutylpyrimidine (PubChem CID 18329571) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 2-cyclobutylpyrimidine.
Molecular Properties
| Compound Name | 2-cyclobutylpyrimidine |
| PubChem CID | 18329571 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 2-cyclobutylpyrimidine |
| SMILES | c1cnc(C2CCC2)nc1 |
| InChI | InChI=1S/C8H10N2/c1-3-7(4-1)8-9-5-2-6-10-8/h2,5-7H,1,3-4H2 |
| InChIKey | QIGOWOORIOSGGG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclobutylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutylpyrimidine?
The IUPAC name of 2-cyclobutylpyrimidine (CID 18329571) is 2-cyclobutylpyrimidine.
What is the SMILES notation for 2-cyclobutylpyrimidine?
The canonical SMILES for 2-cyclobutylpyrimidine is c1cnc(C2CCC2)nc1.
What is the InChIKey of 2-cyclobutylpyrimidine?
The InChIKey is QIGOWOORIOSGGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-3-7(4-1)8-9-5-2-6-10-8/h2,5-7H,1,3-4H2.
What are the key properties of 2-cyclobutylpyrimidine?
2-cyclobutylpyrimidine has a molecular weight of 134.18 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutylpyrimidine is sourced from PubChem (CID 18329571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).