About 2-piperidin-1-yl-1H-1,4-diazepine
2-piperidin-1-yl-1H-1,4-diazepine (PubChem CID 18329617) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-piperidin-1-yl-1H-1,4-diazepine.
Molecular Properties
| Compound Name | 2-piperidin-1-yl-1H-1,4-diazepine |
| PubChem CID | 18329617 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 2-piperidin-1-yl-1H-1,4-diazepine |
| SMILES | C1=CNC(N2CCCCC2)=CN=C1 |
| InChI | InChI=1S/C10H15N3/c1-2-7-13(8-3-1)10-9-11-5-4-6-12-10/h4-6,9,12H,1-3,7-8H2 |
| InChIKey | YSJJGPCKGKJJHA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-piperidin-1-yl-1H-1,4-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-yl-1H-1,4-diazepine?
The IUPAC name of 2-piperidin-1-yl-1H-1,4-diazepine (CID 18329617) is 2-piperidin-1-yl-1H-1,4-diazepine.
What is the SMILES notation for 2-piperidin-1-yl-1H-1,4-diazepine?
The canonical SMILES for 2-piperidin-1-yl-1H-1,4-diazepine is C1=CNC(N2CCCCC2)=CN=C1.
What is the InChIKey of 2-piperidin-1-yl-1H-1,4-diazepine?
The InChIKey is YSJJGPCKGKJJHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3/c1-2-7-13(8-3-1)10-9-11-5-4-6-12-10/h4-6,9,12H,1-3,7-8H2.
What are the key properties of 2-piperidin-1-yl-1H-1,4-diazepine?
2-piperidin-1-yl-1H-1,4-diazepine has a molecular weight of 177.25 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-yl-1H-1,4-diazepine is sourced from PubChem (CID 18329617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).