About quinoxaline-2,3-dione;hydrate
quinoxaline-2,3-dione;hydrate (PubChem CID 18329724) has the molecular formula C8H6N2O3
and a molecular weight of 178.15 g/mol. Its IUPAC name is quinoxaline-2,3-dione;hydrate.
Molecular Properties
| Compound Name | quinoxaline-2,3-dione;hydrate |
| PubChem CID | 18329724 |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | quinoxaline-2,3-dione;hydrate |
| SMILES | O.O=C1N=c2ccccc2=NC1=O |
| InChI | InChI=1S/C8H4N2O2.H2O/c11-7-8(12)10-6-4-2-1-3-5(6)9-7;/h1-4H;1H2 |
| InChIKey | VUENVSBIKQKNRB-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 90.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze quinoxaline-2,3-dione;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoxaline-2,3-dione;hydrate?
The IUPAC name of quinoxaline-2,3-dione;hydrate (CID 18329724) is quinoxaline-2,3-dione;hydrate.
What is the SMILES notation for quinoxaline-2,3-dione;hydrate?
The canonical SMILES for quinoxaline-2,3-dione;hydrate is O.O=C1N=c2ccccc2=NC1=O.
What is the InChIKey of quinoxaline-2,3-dione;hydrate?
The InChIKey is VUENVSBIKQKNRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2O2.H2O/c11-7-8(12)10-6-4-2-1-3-5(6)9-7;/h1-4H;1H2.
What are the key properties of quinoxaline-2,3-dione;hydrate?
quinoxaline-2,3-dione;hydrate has a molecular weight of 178.15 g/mol, XLogP of -1.83, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinoxaline-2,3-dione;hydrate is sourced from PubChem (CID 18329724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).