About trimethyl-[1-(1,2,4-triazol-1-ylmethoxy)ethoxy]silane
trimethyl-[1-(1,2,4-triazol-1-ylmethoxy)ethoxy]silane (PubChem CID 18329892) has the molecular formula C8H17N3O2Si
and a molecular weight of 215.33 g/mol. Its IUPAC name is trimethyl-[1-(1,2,4-triazol-1-ylmethoxy)ethoxy]silane.
Molecular Properties
| Compound Name | trimethyl-[1-(1,2,4-triazol-1-ylmethoxy)ethoxy]silane |
| PubChem CID | 18329892 |
| Molecular Formula | C8H17N3O2Si |
| Molecular Weight | 215.33 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | trimethyl-[1-(1,2,4-triazol-1-ylmethoxy)ethoxy]silane |
| SMILES | CC(OCn1cncn1)O[Si](C)(C)C |
| InChI | InChI=1S/C8H17N3O2Si/c1-8(13-14(2,3)4)12-7-11-6-9-5-10-11/h5-6,8H,7H2,1-4H3 |
| InChIKey | FFCYPTDZCPIZBR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[1-(1,2,4-triazol-1-ylmethoxy)ethoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[1-(1,2,4-triazol-1-ylmethoxy)ethoxy]silane?
The IUPAC name of trimethyl-[1-(1,2,4-triazol-1-ylmethoxy)ethoxy]silane (CID 18329892) is trimethyl-[1-(1,2,4-triazol-1-ylmethoxy)ethoxy]silane.
What is the SMILES notation for trimethyl-[1-(1,2,4-triazol-1-ylmethoxy)ethoxy]silane?
The canonical SMILES for trimethyl-[1-(1,2,4-triazol-1-ylmethoxy)ethoxy]silane is CC(OCn1cncn1)O[Si](C)(C)C.
What is the InChIKey of trimethyl-[1-(1,2,4-triazol-1-ylmethoxy)ethoxy]silane?
The InChIKey is FFCYPTDZCPIZBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O2Si/c1-8(13-14(2,3)4)12-7-11-6-9-5-10-11/h5-6,8H,7H2,1-4H3.
What are the key properties of trimethyl-[1-(1,2,4-triazol-1-ylmethoxy)ethoxy]silane?
trimethyl-[1-(1,2,4-triazol-1-ylmethoxy)ethoxy]silane has a molecular weight of 215.33 g/mol, XLogP of 1.45, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[1-(1,2,4-triazol-1-ylmethoxy)ethoxy]silane is sourced from PubChem (CID 18329892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).