C23H20N2O — CID 18330802
4-(2,5-diphenyl-1,3-oxazol-4-yl)-N,N-dimethylaniline (PubChem CID 18330802) has the molecular formula C23H20N2O and a molecular weight of 340.43 g/mol. Its IUPAC name is 4-(2,5-diphenyl-1,3-oxazol-4-yl)-N,N-dimethylaniline.
| Compound Name | 4-(2,5-diphenyl-1,3-oxazol-4-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 18330802 |
| Molecular Formula | C23H20N2O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 4-(2,5-diphenyl-1,3-oxazol-4-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2nc(-c3ccccc3)oc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N2O/c1-25(2)20-15-13-17(14-16-20)21-22(18-9-5-3-6-10-18)26-23(24-21)19-11-7-4-8-12-19/h3-16H,1-2H3 |
| InChIKey | FATMRNKHKKKOLC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |