About 6-methyl-2-[(6-methyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole
6-methyl-2-[(6-methyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole (PubChem CID 18330967) has the molecular formula C16H12N2S4
and a molecular weight of 360.55 g/mol. Its IUPAC name is 6-methyl-2-[(6-methyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-methyl-2-[(6-methyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole |
| PubChem CID | 18330967 |
| Molecular Formula | C16H12N2S4 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | 6-methyl-2-[(6-methyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole |
| SMILES | Cc1ccc2nc(SSc3nc4ccc(C)cc4s3)sc2c1 |
| InChI | InChI=1S/C16H12N2S4/c1-9-3-5-11-13(7-9)19-15(17-11)21-22-16-18-12-6-4-10(2)8-14(12)20-16/h3-8H,1-2H3 |
| InChIKey | SKQWJYKBNFADLR-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-2-[(6-methyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-[(6-methyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole?
The IUPAC name of 6-methyl-2-[(6-methyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole (CID 18330967) is 6-methyl-2-[(6-methyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole.
What is the SMILES notation for 6-methyl-2-[(6-methyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole?
The canonical SMILES for 6-methyl-2-[(6-methyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole is Cc1ccc2nc(SSc3nc4ccc(C)cc4s3)sc2c1.
What is the InChIKey of 6-methyl-2-[(6-methyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole?
The InChIKey is SKQWJYKBNFADLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2S4/c1-9-3-5-11-13(7-9)19-15(17-11)21-22-16-18-12-6-4-10(2)8-14(12)20-16/h3-8H,1-2H3.
What are the key properties of 6-methyl-2-[(6-methyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole?
6-methyl-2-[(6-methyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole has a molecular weight of 360.55 g/mol, XLogP of 6.32, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-[(6-methyl-1,3-benzothiazol-2-yl)disulfanyl]-1,3-benzothiazole is sourced from PubChem (CID 18330967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).