About (6-methylidenecyclohexa-1,3-dien-1-yl)hydrazine
(6-methylidenecyclohexa-1,3-dien-1-yl)hydrazine (PubChem CID 18331059) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is (6-methylidenecyclohexa-1,3-dien-1-yl)hydrazine.
Molecular Properties
| Compound Name | (6-methylidenecyclohexa-1,3-dien-1-yl)hydrazine |
| PubChem CID | 18331059 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | (6-methylidenecyclohexa-1,3-dien-1-yl)hydrazine |
| SMILES | C=C1CC=CC=C1NN |
| InChI | InChI=1S/C7H10N2/c1-6-4-2-3-5-7(6)9-8/h2-3,5,9H,1,4,8H2 |
| InChIKey | GFYPATJOBOQBMN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6-methylidenecyclohexa-1,3-dien-1-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methylidenecyclohexa-1,3-dien-1-yl)hydrazine?
The IUPAC name of (6-methylidenecyclohexa-1,3-dien-1-yl)hydrazine (CID 18331059) is (6-methylidenecyclohexa-1,3-dien-1-yl)hydrazine.
What is the SMILES notation for (6-methylidenecyclohexa-1,3-dien-1-yl)hydrazine?
The canonical SMILES for (6-methylidenecyclohexa-1,3-dien-1-yl)hydrazine is C=C1CC=CC=C1NN.
What is the InChIKey of (6-methylidenecyclohexa-1,3-dien-1-yl)hydrazine?
The InChIKey is GFYPATJOBOQBMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2/c1-6-4-2-3-5-7(6)9-8/h2-3,5,9H,1,4,8H2.
What are the key properties of (6-methylidenecyclohexa-1,3-dien-1-yl)hydrazine?
(6-methylidenecyclohexa-1,3-dien-1-yl)hydrazine has a molecular weight of 122.17 g/mol, XLogP of 0.85, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methylidenecyclohexa-1,3-dien-1-yl)hydrazine is sourced from PubChem (CID 18331059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).