C21H26O2 — CID 18331119
17-ethynyl-6-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 18331119) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 17-ethynyl-6-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 17-ethynyl-6-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 18331119 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 17-ethynyl-6-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C#CC1=CCC2C3CC(O)C4=CC(=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C21H26O2/c1-4-13-5-6-16-15-12-19(23)18-11-14(22)7-9-21(18,3)17(15)8-10-20(13,16)2/h1,5,11,15-17,19,23H,6-10,12H2,2-3H3 |
| InChIKey | PPBBDHSCDNXWGO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|