About 7H-purine;pyrimidine
7H-purine;pyrimidine (PubChem CID 18331659) has the molecular formula C9H8N6
and a molecular weight of 200.21 g/mol. Its IUPAC name is 7H-purine;pyrimidine.
Molecular Properties
| Compound Name | 7H-purine;pyrimidine |
| PubChem CID | 18331659 |
| Molecular Formula | C9H8N6 |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 7H-purine;pyrimidine |
| SMILES | c1cncnc1.c1ncc2[nH]cnc2n1 |
| InChI | InChI=1S/C5H4N4.C4H4N2/c1-4-5(8-2-6-1)9-3-7-4;1-2-5-4-6-3-1/h1-3H,(H,6,7,8,9);1-4H |
| InChIKey | CZVCGJBESNRLEQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7H-purine;pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-purine;pyrimidine?
The IUPAC name of 7H-purine;pyrimidine (CID 18331659) is 7H-purine;pyrimidine.
What is the SMILES notation for 7H-purine;pyrimidine?
The canonical SMILES for 7H-purine;pyrimidine is c1cncnc1.c1ncc2[nH]cnc2n1.
What is the InChIKey of 7H-purine;pyrimidine?
The InChIKey is CZVCGJBESNRLEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4.C4H4N2/c1-4-5(8-2-6-1)9-3-7-4;1-2-5-4-6-3-1/h1-3H,(H,6,7,8,9);1-4H.
What are the key properties of 7H-purine;pyrimidine?
7H-purine;pyrimidine has a molecular weight of 200.21 g/mol, XLogP of 0.83, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-purine;pyrimidine is sourced from PubChem (CID 18331659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).