About azane;propan-2-ol
azane;propan-2-ol (PubChem CID 18331942) has the molecular formula C3H11NO
and a molecular weight of 77.13 g/mol. Its IUPAC name is azane;propan-2-ol.
Molecular Properties
| Compound Name | azane;propan-2-ol |
| PubChem CID | 18331942 |
| Molecular Formula | C3H11NO |
| Molecular Weight | 77.13 g/mol |
| Exact Mass | 77.08 |
| IUPAC Name | azane;propan-2-ol |
| SMILES | CC(C)O.N |
| InChI | InChI=1S/C3H8O.H3N/c1-3(2)4;/h3-4H,1-2H3;1H3 |
| InChIKey | KQQCTWHSWXCZHB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 77.13 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;propan-2-ol?
The IUPAC name of azane;propan-2-ol (CID 18331942) is azane;propan-2-ol.
What is the SMILES notation for azane;propan-2-ol?
The canonical SMILES for azane;propan-2-ol is CC(C)O.N.
What is the InChIKey of azane;propan-2-ol?
The InChIKey is KQQCTWHSWXCZHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.H3N/c1-3(2)4;/h3-4H,1-2H3;1H3.
What are the key properties of azane;propan-2-ol?
azane;propan-2-ol has a molecular weight of 77.13 g/mol, XLogP of 0.55, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;propan-2-ol is sourced from PubChem (CID 18331942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).