About 2-hexan-2-ylmorpholine
2-hexan-2-ylmorpholine (PubChem CID 18331948) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is 2-hexan-2-ylmorpholine.
Molecular Properties
| Compound Name | 2-hexan-2-ylmorpholine |
| PubChem CID | 18331948 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | 2-hexan-2-ylmorpholine |
| SMILES | CCCCC(C)C1CNCCO1 |
| InChI | InChI=1S/C10H21NO/c1-3-4-5-9(2)10-8-11-6-7-12-10/h9-11H,3-8H2,1-2H3 |
| InChIKey | RTVQITWKXRSLAF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hexan-2-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexan-2-ylmorpholine?
The IUPAC name of 2-hexan-2-ylmorpholine (CID 18331948) is 2-hexan-2-ylmorpholine.
What is the SMILES notation for 2-hexan-2-ylmorpholine?
The canonical SMILES for 2-hexan-2-ylmorpholine is CCCCC(C)C1CNCCO1.
What is the InChIKey of 2-hexan-2-ylmorpholine?
The InChIKey is RTVQITWKXRSLAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO/c1-3-4-5-9(2)10-8-11-6-7-12-10/h9-11H,3-8H2,1-2H3.
What are the key properties of 2-hexan-2-ylmorpholine?
2-hexan-2-ylmorpholine has a molecular weight of 171.28 g/mol, XLogP of 1.80, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexan-2-ylmorpholine is sourced from PubChem (CID 18331948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).