C25H26N6O2 — CID 18332604
benzyl 4-[[4-(benzimidazol-1-yl)pyrimidin-2-yl]-methylamino]piperidine-1-carboxylate (PubChem CID 18332604) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is benzyl 4-[[4-(benzimidazol-1-yl)pyrimidin-2-yl]-methylamino]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[[4-(benzimidazol-1-yl)pyrimidin-2-yl]-methylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 18332604 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | benzyl 4-[[4-(benzimidazol-1-yl)pyrimidin-2-yl]-methylamino]piperidine-1-carboxylate |
| SMILES | CN(c1nccc(-n2cnc3ccccc32)n1)C1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C25H26N6O2/c1-29(20-12-15-30(16-13-20)25(32)33-17-19-7-3-2-4-8-19)24-26-14-11-23(28-24)31-18-27-21-9-5-6-10-22(21)31/h2-11,14,18,20H,12-13,15-17H2,1H3 |
| InChIKey | FTMNDQNNJJZTNR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |