C22H28N6O2 — CID 18332624
ethyl 2-[3-[1-[[4-(benzimidazol-1-yl)pyrimidin-2-yl]amino]ethyl]piperidin-1-yl]acetate (PubChem CID 18332624) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is ethyl 2-[3-[1-[[4-(benzimidazol-1-yl)pyrimidin-2-yl]amino]ethyl]piperidin-1-yl]acetate.
| Compound Name | ethyl 2-[3-[1-[[4-(benzimidazol-1-yl)pyrimidin-2-yl]amino]ethyl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 18332624 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | ethyl 2-[3-[1-[[4-(benzimidazol-1-yl)pyrimidin-2-yl]amino]ethyl]piperidin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCCC(C(C)Nc2nccc(-n3cnc4ccccc43)n2)C1 |
| InChI | InChI=1S/C22H28N6O2/c1-3-30-21(29)14-27-12-6-7-17(13-27)16(2)25-22-23-11-10-20(26-22)28-15-24-18-8-4-5-9-19(18)28/h4-5,8-11,15-17H,3,6-7,12-14H2,1-2H3,(H,23,25,26) |
| InChIKey | MZEVMAFZGIOARS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |