C40H42N10O5 — CID 18332662
(4-nitrophenyl) N-[1-[[1-[2-[1-[1-(naphthalen-1-ylcarbamoyl)piperidin-3-yl]ethylamino]pyrimidin-4-yl]benzimidazol-5-yl]amino]butyl]carbamate (PubChem CID 18332662) has the molecular formula C40H42N10O5 and a molecular weight of 742.84 g/mol. Its IUPAC name is (4-nitrophenyl) N-[1-[[1-[2-[1-[1-(naphthalen-1-ylcarbamoyl)piperidin-3-yl]ethylamino]pyrimidin-4-yl]benzimidazol-5-yl]amino]butyl]carbamate.
| Compound Name | (4-nitrophenyl) N-[1-[[1-[2-[1-[1-(naphthalen-1-ylcarbamoyl)piperidin-3-yl]ethylamino]pyrimidin-4-yl]benzimidazol-5-yl]amino]butyl]carbamate |
|---|---|
| PubChem CID | 18332662 |
| Molecular Formula | C40H42N10O5 |
| Molecular Weight | 742.84 g/mol |
| Exact Mass | 742.33 |
| IUPAC Name | (4-nitrophenyl) N-[1-[[1-[2-[1-[1-(naphthalen-1-ylcarbamoyl)piperidin-3-yl]ethylamino]pyrimidin-4-yl]benzimidazol-5-yl]amino]butyl]carbamate |
| SMILES | CCCC(NC(=O)Oc1ccc([N+](=O)[O-])cc1)Nc1ccc2c(c1)ncn2-c1ccnc(NC(C)C2CCCN(C(=O)Nc3cccc4ccccc34)C2)n1 |
| InChI | InChI=1S/C40H42N10O5/c1-3-8-36(46-40(52)55-31-17-15-30(16-18-31)50(53)54)44-29-14-19-35-34(23-29)42-25-49(35)37-20-21-41-38(47-37)43-26(2)28-11-7-22-48(24-28)39(51)45-33-13-6-10-27-9-4-5-12-32(27)33/h4-6,9-10,12-21,23,25-26,28,36,44H,3,7-8,11,22,24H2,1-2H3,(H,45,51)(H,46,52)(H,41,43,47) |
| InChIKey | PEATYOUOCPLFOJ-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 181.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.84 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|