About 9-benzyl-8-bromo-2-N-pentylpurine-2,6-diamine
9-benzyl-8-bromo-2-N-pentylpurine-2,6-diamine (PubChem CID 18332813) has the molecular formula C17H21BrN6
and a molecular weight of 389.30 g/mol. Its IUPAC name is 9-benzyl-8-bromo-2-N-pentylpurine-2,6-diamine.
Molecular Properties
| Compound Name | 9-benzyl-8-bromo-2-N-pentylpurine-2,6-diamine |
| PubChem CID | 18332813 |
| Molecular Formula | C17H21BrN6 |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 9-benzyl-8-bromo-2-N-pentylpurine-2,6-diamine |
| SMILES | CCCCCNc1nc(N)c2nc(Br)n(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C17H21BrN6/c1-2-3-7-10-20-17-22-14(19)13-15(23-17)24(16(18)21-13)11-12-8-5-4-6-9-12/h4-6,8-9H,2-3,7,10-11H2,1H3,(H3,19,20,22,23) |
| InChIKey | PGCKOUKOVMTWDV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-benzyl-8-bromo-2-N-pentylpurine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-benzyl-8-bromo-2-N-pentylpurine-2,6-diamine?
The IUPAC name of 9-benzyl-8-bromo-2-N-pentylpurine-2,6-diamine (CID 18332813) is 9-benzyl-8-bromo-2-N-pentylpurine-2,6-diamine.
What is the SMILES notation for 9-benzyl-8-bromo-2-N-pentylpurine-2,6-diamine?
The canonical SMILES for 9-benzyl-8-bromo-2-N-pentylpurine-2,6-diamine is CCCCCNc1nc(N)c2nc(Br)n(Cc3ccccc3)c2n1.
What is the InChIKey of 9-benzyl-8-bromo-2-N-pentylpurine-2,6-diamine?
The InChIKey is PGCKOUKOVMTWDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21BrN6/c1-2-3-7-10-20-17-22-14(19)13-15(23-17)24(16(18)21-13)11-12-8-5-4-6-9-12/h4-6,8-9H,2-3,7,10-11H2,1H3,(H3,19,20,22,23).
What are the key properties of 9-benzyl-8-bromo-2-N-pentylpurine-2,6-diamine?
9-benzyl-8-bromo-2-N-pentylpurine-2,6-diamine has a molecular weight of 389.30 g/mol, XLogP of 3.82, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-benzyl-8-bromo-2-N-pentylpurine-2,6-diamine is sourced from PubChem (CID 18332813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).