About methyl 2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate
methyl 2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate (PubChem CID 18333017) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is methyl 2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate |
| PubChem CID | 18333017 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | methyl 2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate |
| SMILES | COC(=O)C1Cc2ccccc2NC1=O |
| InChI | InChI=1S/C11H11NO3/c1-15-11(14)8-6-7-4-2-3-5-9(7)12-10(8)13/h2-5,8H,6H2,1H3,(H,12,13) |
| InChIKey | JDKYMNFPRFYLKN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate?
The IUPAC name of methyl 2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate (CID 18333017) is methyl 2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate.
What is the SMILES notation for methyl 2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate?
The canonical SMILES for methyl 2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate is COC(=O)C1Cc2ccccc2NC1=O.
What is the InChIKey of methyl 2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate?
The InChIKey is JDKYMNFPRFYLKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c1-15-11(14)8-6-7-4-2-3-5-9(7)12-10(8)13/h2-5,8H,6H2,1H3,(H,12,13).
What are the key properties of methyl 2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate?
methyl 2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate has a molecular weight of 205.21 g/mol, XLogP of 0.97, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-oxo-3,4-dihydro-1H-quinoline-3-carboxylate is sourced from PubChem (CID 18333017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).