C21H18F2N2O3 — CID 18334142
N-[(3,4-difluorophenyl)methyl]-1-(4-methoxyphenyl)-1-(3-nitrophenyl)methanamine (PubChem CID 18334142) has the molecular formula C21H18F2N2O3 and a molecular weight of 384.38 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-1-(4-methoxyphenyl)-1-(3-nitrophenyl)methanamine.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-1-(4-methoxyphenyl)-1-(3-nitrophenyl)methanamine |
|---|---|
| PubChem CID | 18334142 |
| Molecular Formula | C21H18F2N2O3 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-1-(4-methoxyphenyl)-1-(3-nitrophenyl)methanamine |
| SMILES | COc1ccc(C(NCc2ccc(F)c(F)c2)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C21H18F2N2O3/c1-28-18-8-6-15(7-9-18)21(16-3-2-4-17(12-16)25(26)27)24-13-14-5-10-19(22)20(23)11-14/h2-12,21,24H,13H2,1H3 |
| InChIKey | YOLYUCJBINBWMS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|