About 3-ethyl-5,6-dimethyl-2-(methylamino)pyrimidin-4-one
3-ethyl-5,6-dimethyl-2-(methylamino)pyrimidin-4-one (PubChem CID 18334354) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-ethyl-5,6-dimethyl-2-(methylamino)pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-ethyl-5,6-dimethyl-2-(methylamino)pyrimidin-4-one |
| PubChem CID | 18334354 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 3-ethyl-5,6-dimethyl-2-(methylamino)pyrimidin-4-one |
| SMILES | CCn1c(NC)nc(C)c(C)c1=O |
| InChI | InChI=1S/C9H15N3O/c1-5-12-8(13)6(2)7(3)11-9(12)10-4/h5H2,1-4H3,(H,10,11) |
| InChIKey | DIZIGLWOOYUOOV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-5,6-dimethyl-2-(methylamino)pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5,6-dimethyl-2-(methylamino)pyrimidin-4-one?
The IUPAC name of 3-ethyl-5,6-dimethyl-2-(methylamino)pyrimidin-4-one (CID 18334354) is 3-ethyl-5,6-dimethyl-2-(methylamino)pyrimidin-4-one.
What is the SMILES notation for 3-ethyl-5,6-dimethyl-2-(methylamino)pyrimidin-4-one?
The canonical SMILES for 3-ethyl-5,6-dimethyl-2-(methylamino)pyrimidin-4-one is CCn1c(NC)nc(C)c(C)c1=O.
What is the InChIKey of 3-ethyl-5,6-dimethyl-2-(methylamino)pyrimidin-4-one?
The InChIKey is DIZIGLWOOYUOOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-5-12-8(13)6(2)7(3)11-9(12)10-4/h5H2,1-4H3,(H,10,11).
What are the key properties of 3-ethyl-5,6-dimethyl-2-(methylamino)pyrimidin-4-one?
3-ethyl-5,6-dimethyl-2-(methylamino)pyrimidin-4-one has a molecular weight of 181.24 g/mol, XLogP of 0.92, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5,6-dimethyl-2-(methylamino)pyrimidin-4-one is sourced from PubChem (CID 18334354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).