C25H28N2O3S — CID 18334454
2-[[2-(1,2-dimethyl-5-oxophenothiazin-10-yl)ethyl-methylamino]methyl]-6-(hydroxymethyl)phenol (PubChem CID 18334454) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is 2-[[2-(1,2-dimethyl-5-oxophenothiazin-10-yl)ethyl-methylamino]methyl]-6-(hydroxymethyl)phenol.
| Compound Name | 2-[[2-(1,2-dimethyl-5-oxophenothiazin-10-yl)ethyl-methylamino]methyl]-6-(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 18334454 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-[[2-(1,2-dimethyl-5-oxophenothiazin-10-yl)ethyl-methylamino]methyl]-6-(hydroxymethyl)phenol |
| SMILES | Cc1ccc2c(c1C)N(CCN(C)Cc1cccc(CO)c1O)c1ccccc1S2=O |
| InChI | InChI=1S/C25H28N2O3S/c1-17-11-12-23-24(18(17)2)27(21-9-4-5-10-22(21)31(23)30)14-13-26(3)15-19-7-6-8-20(16-28)25(19)29/h4-12,28-29H,13-16H2,1-3H3 |
| InChIKey | BMDVKJUOPFQGPA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|