About 3-[(9E)-9-ethoxyimino-3,4-dimethylacridin-10-yl]-N-(1-phenylethyl)propan-1-amine
3-[(9E)-9-ethoxyimino-3,4-dimethylacridin-10-yl]-N-(1-phenylethyl)propan-1-amine (PubChem CID 18334577) has the molecular formula C28H33N3O
and a molecular weight of 427.59 g/mol. Its IUPAC name is 3-[(9E)-9-ethoxyimino-3,4-dimethylacridin-10-yl]-N-(1-phenylethyl)propan-1-amine.
Molecular Properties
| Compound Name | 3-[(9E)-9-ethoxyimino-3,4-dimethylacridin-10-yl]-N-(1-phenylethyl)propan-1-amine |
| PubChem CID | 18334577 |
| Molecular Formula | C28H33N3O |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 3-[(9E)-9-ethoxyimino-3,4-dimethylacridin-10-yl]-N-(1-phenylethyl)propan-1-amine |
| SMILES | CCO/N=c1\c2ccccc2n(CCCNC(C)c2ccccc2)c2c(C)c(C)ccc12 |
| InChI | InChI=1S/C28H33N3O/c1-5-32-30-27-24-14-9-10-15-26(24)31(28-21(3)20(2)16-17-25(27)28)19-11-18-29-22(4)23-12-7-6-8-13-23/h6-10,12-17,22,29H,5,11,18-19H2,1-4H3/b30-27+ |
| InChIKey | ZEEDXNSGCGGBKN-KDJFERLWSA-N |
| XLogP | 6.00 |
| TPSA | 38.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[(9E)-9-ethoxyimino-3,4-dimethylacridin-10-yl]-N-(1-phenylethyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(9E)-9-ethoxyimino-3,4-dimethylacridin-10-yl]-N-(1-phenylethyl)propan-1-amine?
The IUPAC name of 3-[(9E)-9-ethoxyimino-3,4-dimethylacridin-10-yl]-N-(1-phenylethyl)propan-1-amine (CID 18334577) is 3-[(9E)-9-ethoxyimino-3,4-dimethylacridin-10-yl]-N-(1-phenylethyl)propan-1-amine.
What is the SMILES notation for 3-[(9E)-9-ethoxyimino-3,4-dimethylacridin-10-yl]-N-(1-phenylethyl)propan-1-amine?
The canonical SMILES for 3-[(9E)-9-ethoxyimino-3,4-dimethylacridin-10-yl]-N-(1-phenylethyl)propan-1-amine is CCO/N=c1\c2ccccc2n(CCCNC(C)c2ccccc2)c2c(C)c(C)ccc12.
What is the InChIKey of 3-[(9E)-9-ethoxyimino-3,4-dimethylacridin-10-yl]-N-(1-phenylethyl)propan-1-amine?
The InChIKey is ZEEDXNSGCGGBKN-KDJFERLWSA-N. The full InChI is InChI=1S/C28H33N3O/c1-5-32-30-27-24-14-9-10-15-26(24)31(28-21(3)20(2)16-17-25(27)28)19-11-18-29-22(4)23-12-7-6-8-13-23/h6-10,12-17,22,29H,5,11,18-19H2,1-4H3/b30-27+.
What are the key properties of 3-[(9E)-9-ethoxyimino-3,4-dimethylacridin-10-yl]-N-(1-phenylethyl)propan-1-amine?
3-[(9E)-9-ethoxyimino-3,4-dimethylacridin-10-yl]-N-(1-phenylethyl)propan-1-amine has a molecular weight of 427.59 g/mol, XLogP of 6.00, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(9E)-9-ethoxyimino-3,4-dimethylacridin-10-yl]-N-(1-phenylethyl)propan-1-amine is sourced from PubChem (CID 18334577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).