C24H26N2O2S — CID 18334625
N-benzyl-3-(1,2-dimethyl-5,5-dioxophenothiazin-10-yl)propan-1-amine (PubChem CID 18334625) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is N-benzyl-3-(1,2-dimethyl-5,5-dioxophenothiazin-10-yl)propan-1-amine.
| Compound Name | N-benzyl-3-(1,2-dimethyl-5,5-dioxophenothiazin-10-yl)propan-1-amine |
|---|---|
| PubChem CID | 18334625 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-benzyl-3-(1,2-dimethyl-5,5-dioxophenothiazin-10-yl)propan-1-amine |
| SMILES | Cc1ccc2c(c1C)N(CCCNCc1ccccc1)c1ccccc1S2(=O)=O |
| InChI | InChI=1S/C24H26N2O2S/c1-18-13-14-23-24(19(18)2)26(21-11-6-7-12-22(21)29(23,27)28)16-8-15-25-17-20-9-4-3-5-10-20/h3-7,9-14,25H,8,15-17H2,1-2H3 |
| InChIKey | ZBNKPSNJNNFSQB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|