C20H17F3N6O — CID 18334729
4-[2-[[2-oxo-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-3-yl]methyl]benzimidazol-1-yl]butanenitrile (PubChem CID 18334729) has the molecular formula C20H17F3N6O and a molecular weight of 414.39 g/mol. Its IUPAC name is 4-[2-[[2-oxo-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-3-yl]methyl]benzimidazol-1-yl]butanenitrile.
| Compound Name | 4-[2-[[2-oxo-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-3-yl]methyl]benzimidazol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 18334729 |
| Molecular Formula | C20H17F3N6O |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 4-[2-[[2-oxo-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-3-yl]methyl]benzimidazol-1-yl]butanenitrile |
| SMILES | N#CCCCn1c(Cn2c(=O)n(CC(F)(F)F)c3ccncc32)nc2ccccc21 |
| InChI | InChI=1S/C20H17F3N6O/c21-20(22,23)13-29-16-7-9-25-11-17(16)28(19(29)30)12-18-26-14-5-1-2-6-15(14)27(18)10-4-3-8-24/h1-2,5-7,9,11H,3-4,10,12-13H2 |
| InChIKey | RMNMUWNNOBHYLU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 81.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|