C27H26F3N5O2 — CID 18334848
3-[[1-(4-phenylmethoxybutyl)benzimidazol-2-yl]methyl]-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-2-one (PubChem CID 18334848) has the molecular formula C27H26F3N5O2 and a molecular weight of 509.53 g/mol. Its IUPAC name is 3-[[1-(4-phenylmethoxybutyl)benzimidazol-2-yl]methyl]-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-2-one.
| Compound Name | 3-[[1-(4-phenylmethoxybutyl)benzimidazol-2-yl]methyl]-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 18334848 |
| Molecular Formula | C27H26F3N5O2 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 3-[[1-(4-phenylmethoxybutyl)benzimidazol-2-yl]methyl]-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-2-one |
| SMILES | O=c1n(Cc2nc3ccccc3n2CCCCOCc2ccccc2)c2cnccc2n1CC(F)(F)F |
| InChI | InChI=1S/C27H26F3N5O2/c28-27(29,30)19-35-23-12-13-31-16-24(23)34(26(35)36)17-25-32-21-10-4-5-11-22(21)33(25)14-6-7-15-37-18-20-8-2-1-3-9-20/h1-5,8-13,16H,6-7,14-15,17-19H2 |
| InChIKey | UPOQAVCNUWOIKF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 66.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|