C20H19F4N5O — CID 18334851
3-[[1-(4-fluorobutyl)benzimidazol-2-yl]methyl]-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-2-one (PubChem CID 18334851) has the molecular formula C20H19F4N5O and a molecular weight of 421.40 g/mol. Its IUPAC name is 3-[[1-(4-fluorobutyl)benzimidazol-2-yl]methyl]-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-2-one.
| Compound Name | 3-[[1-(4-fluorobutyl)benzimidazol-2-yl]methyl]-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 18334851 |
| Molecular Formula | C20H19F4N5O |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 3-[[1-(4-fluorobutyl)benzimidazol-2-yl]methyl]-1-(2,2,2-trifluoroethyl)imidazo[4,5-c]pyridin-2-one |
| SMILES | O=c1n(Cc2nc3ccccc3n2CCCCF)c2cnccc2n1CC(F)(F)F |
| InChI | InChI=1S/C20H19F4N5O/c21-8-3-4-10-27-15-6-2-1-5-14(15)26-18(27)12-28-17-11-25-9-7-16(17)29(19(28)30)13-20(22,23)24/h1-2,5-7,9,11H,3-4,8,10,12-13H2 |
| InChIKey | ZFHZJGWAJOWZGK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 57.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|