About 9-(2,2,2-trifluoroethyl)-7H-purin-8-one
9-(2,2,2-trifluoroethyl)-7H-purin-8-one (PubChem CID 18334862) has the molecular formula C7H5F3N4O
and a molecular weight of 218.14 g/mol. Its IUPAC name is 9-(2,2,2-trifluoroethyl)-7H-purin-8-one.
Molecular Properties
| Compound Name | 9-(2,2,2-trifluoroethyl)-7H-purin-8-one |
| PubChem CID | 18334862 |
| Molecular Formula | C7H5F3N4O |
| Molecular Weight | 218.14 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 9-(2,2,2-trifluoroethyl)-7H-purin-8-one |
| SMILES | O=c1[nH]c2cncnc2n1CC(F)(F)F |
| InChI | InChI=1S/C7H5F3N4O/c8-7(9,10)2-14-5-4(13-6(14)15)1-11-3-12-5/h1,3H,2H2,(H,13,15) |
| InChIKey | RYCCEISPLSOBOK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.14 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-(2,2,2-trifluoroethyl)-7H-purin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(2,2,2-trifluoroethyl)-7H-purin-8-one?
The IUPAC name of 9-(2,2,2-trifluoroethyl)-7H-purin-8-one (CID 18334862) is 9-(2,2,2-trifluoroethyl)-7H-purin-8-one.
What is the SMILES notation for 9-(2,2,2-trifluoroethyl)-7H-purin-8-one?
The canonical SMILES for 9-(2,2,2-trifluoroethyl)-7H-purin-8-one is O=c1[nH]c2cncnc2n1CC(F)(F)F.
What is the InChIKey of 9-(2,2,2-trifluoroethyl)-7H-purin-8-one?
The InChIKey is RYCCEISPLSOBOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3N4O/c8-7(9,10)2-14-5-4(13-6(14)15)1-11-3-12-5/h1,3H,2H2,(H,13,15).
What are the key properties of 9-(2,2,2-trifluoroethyl)-7H-purin-8-one?
9-(2,2,2-trifluoroethyl)-7H-purin-8-one has a molecular weight of 218.14 g/mol, XLogP of 0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(2,2,2-trifluoroethyl)-7H-purin-8-one is sourced from PubChem (CID 18334862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).