C24H25Cl2N9O2 — CID 18334996
N'-[4-(2,4-dichlorophenyl)-5-imidazol-1-ylpyrimidin-2-yl]-N'-[2-(dimethylamino)ethyl]-N-(5-nitro-2-pyridinyl)ethane-1,2-diamine (PubChem CID 18334996) has the molecular formula C24H25Cl2N9O2 and a molecular weight of 542.43 g/mol. Its IUPAC name is N'-[4-(2,4-dichlorophenyl)-5-imidazol-1-ylpyrimidin-2-yl]-N'-[2-(dimethylamino)ethyl]-N-(5-nitro-2-pyridinyl)ethane-1,2-diamine.
| Compound Name | N'-[4-(2,4-dichlorophenyl)-5-imidazol-1-ylpyrimidin-2-yl]-N'-[2-(dimethylamino)ethyl]-N-(5-nitro-2-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 18334996 |
| Molecular Formula | C24H25Cl2N9O2 |
| Molecular Weight | 542.43 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | N'-[4-(2,4-dichlorophenyl)-5-imidazol-1-ylpyrimidin-2-yl]-N'-[2-(dimethylamino)ethyl]-N-(5-nitro-2-pyridinyl)ethane-1,2-diamine |
| SMILES | CN(C)CCN(CCNc1ccc([N+](=O)[O-])cn1)c1ncc(-n2ccnc2)c(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C24H25Cl2N9O2/c1-32(2)11-12-33(10-8-28-22-6-4-18(14-29-22)35(36)37)24-30-15-21(34-9-7-27-16-34)23(31-24)19-5-3-17(25)13-20(19)26/h3-7,9,13-16H,8,10-12H2,1-2H3,(H,28,29) |
| InChIKey | ORIFVZGZGQLGQN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 118.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|