C20H16F2N8O2 — CID 18334998
N'-[4-(2,4-difluorophenyl)-5-imidazol-1-ylpyrimidin-2-yl]-N-(5-nitro-2-pyridinyl)ethane-1,2-diamine (PubChem CID 18334998) has the molecular formula C20H16F2N8O2 and a molecular weight of 438.40 g/mol. Its IUPAC name is N'-[4-(2,4-difluorophenyl)-5-imidazol-1-ylpyrimidin-2-yl]-N-(5-nitro-2-pyridinyl)ethane-1,2-diamine.
| Compound Name | N'-[4-(2,4-difluorophenyl)-5-imidazol-1-ylpyrimidin-2-yl]-N-(5-nitro-2-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 18334998 |
| Molecular Formula | C20H16F2N8O2 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | N'-[4-(2,4-difluorophenyl)-5-imidazol-1-ylpyrimidin-2-yl]-N-(5-nitro-2-pyridinyl)ethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1ccc(NCCNc2ncc(-n3ccnc3)c(-c3ccc(F)cc3F)n2)nc1 |
| InChI | InChI=1S/C20H16F2N8O2/c21-13-1-3-15(16(22)9-13)19-17(29-8-7-23-12-29)11-27-20(28-19)25-6-5-24-18-4-2-14(10-26-18)30(31)32/h1-4,7-12H,5-6H2,(H,24,26)(H,25,27,28) |
| InChIKey | NSZKNGLSUKZXNQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|