About tert-butyl N-(1-methyl-2,6-dioxopiperidin-3-yl)carbamate
tert-butyl N-(1-methyl-2,6-dioxopiperidin-3-yl)carbamate (PubChem CID 18335022) has the molecular formula C11H18N2O4
and a molecular weight of 242.27 g/mol. Its IUPAC name is tert-butyl N-(1-methyl-2,6-dioxopiperidin-3-yl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(1-methyl-2,6-dioxopiperidin-3-yl)carbamate |
| PubChem CID | 18335022 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | tert-butyl N-(1-methyl-2,6-dioxopiperidin-3-yl)carbamate |
| SMILES | CN1C(=O)CCC(NC(=O)OC(C)(C)C)C1=O |
| InChI | InChI=1S/C11H18N2O4/c1-11(2,3)17-10(16)12-7-5-6-8(14)13(4)9(7)15/h7H,5-6H2,1-4H3,(H,12,16) |
| InChIKey | FOYROUKGPPBNAN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(1-methyl-2,6-dioxopiperidin-3-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(1-methyl-2,6-dioxopiperidin-3-yl)carbamate?
The IUPAC name of tert-butyl N-(1-methyl-2,6-dioxopiperidin-3-yl)carbamate (CID 18335022) is tert-butyl N-(1-methyl-2,6-dioxopiperidin-3-yl)carbamate.
What is the SMILES notation for tert-butyl N-(1-methyl-2,6-dioxopiperidin-3-yl)carbamate?
The canonical SMILES for tert-butyl N-(1-methyl-2,6-dioxopiperidin-3-yl)carbamate is CN1C(=O)CCC(NC(=O)OC(C)(C)C)C1=O.
What is the InChIKey of tert-butyl N-(1-methyl-2,6-dioxopiperidin-3-yl)carbamate?
The InChIKey is FOYROUKGPPBNAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O4/c1-11(2,3)17-10(16)12-7-5-6-8(14)13(4)9(7)15/h7H,5-6H2,1-4H3,(H,12,16).
What are the key properties of tert-butyl N-(1-methyl-2,6-dioxopiperidin-3-yl)carbamate?
tert-butyl N-(1-methyl-2,6-dioxopiperidin-3-yl)carbamate has a molecular weight of 242.27 g/mol, XLogP of 0.66, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(1-methyl-2,6-dioxopiperidin-3-yl)carbamate is sourced from PubChem (CID 18335022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).