C14H20F4O6S — CID 18335195
3-[2-methoxycarbonyl-4-methyl-5-oxo-5-(2,2,3,3-tetrafluoropropoxy)pentyl]sulfanylpropanoic acid (PubChem CID 18335195) has the molecular formula C14H20F4O6S and a molecular weight of 392.37 g/mol. Its IUPAC name is 3-[2-methoxycarbonyl-4-methyl-5-oxo-5-(2,2,3,3-tetrafluoropropoxy)pentyl]sulfanylpropanoic acid.
| Compound Name | 3-[2-methoxycarbonyl-4-methyl-5-oxo-5-(2,2,3,3-tetrafluoropropoxy)pentyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18335195 |
| Molecular Formula | C14H20F4O6S |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 3-[2-methoxycarbonyl-4-methyl-5-oxo-5-(2,2,3,3-tetrafluoropropoxy)pentyl]sulfanylpropanoic acid |
| SMILES | COC(=O)C(CSCCC(=O)O)CC(C)C(=O)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C14H20F4O6S/c1-8(11(21)24-7-14(17,18)13(15)16)5-9(12(22)23-2)6-25-4-3-10(19)20/h8-9,13H,3-7H2,1-2H3,(H,19,20) |
| InChIKey | PXRAQEGTSHJMPJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|