C28H31Cl2N8NaO6S — CID 18335362
sodium 4-[3-acetamido-4-[[3-tert-butyl-4-cyano-1-(2,6-dichloro-4-nitrophenyl)pyrazol-5-yl]diazenyl]-N-ethylanilino]butane-1-sulfonate (PubChem CID 18335362) has the molecular formula C28H31Cl2N8NaO6S and a molecular weight of 701.57 g/mol. Its IUPAC name is sodium 4-[3-acetamido-4-[[3-tert-butyl-4-cyano-1-(2,6-dichloro-4-nitrophenyl)pyrazol-5-yl]diazenyl]-N-ethylanilino]butane-1-sulfonate.
| Compound Name | sodium 4-[3-acetamido-4-[[3-tert-butyl-4-cyano-1-(2,6-dichloro-4-nitrophenyl)pyrazol-5-yl]diazenyl]-N-ethylanilino]butane-1-sulfonate |
|---|---|
| PubChem CID | 18335362 |
| Molecular Formula | C28H31Cl2N8NaO6S |
| Molecular Weight | 701.57 g/mol |
| Exact Mass | 700.14 |
| IUPAC Name | sodium 4-[3-acetamido-4-[[3-tert-butyl-4-cyano-1-(2,6-dichloro-4-nitrophenyl)pyrazol-5-yl]diazenyl]-N-ethylanilino]butane-1-sulfonate |
| SMILES | CCN(CCCCS(=O)(=O)[O-])c1ccc(/N=N/c2c(C#N)c(C(C)(C)C)nn2-c2c(Cl)cc([N+](=O)[O-])cc2Cl)c(NC(C)=O)c1.[Na+] |
| InChI | InChI=1S/C28H32Cl2N8O6S.Na/c1-6-36(11-7-8-12-45(42,43)44)18-9-10-23(24(15-18)32-17(2)39)33-34-27-20(16-31)26(28(3,4)5)35-37(27)25-21(29)13-19(38(40)41)14-22(25)30;/h9-10,13-15H,6-8,11-12H2,1-5H3,(H,32,39)(H,42,43,44);/q;+1/p-1/b34-33+; |
| InChIKey | BZORYPDBXPUHNX-GGTLNOMSSA-M |
| XLogP | 3.79 |
| TPSA | 199.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.57 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|