C32H24Cl2KN7O4S — CID 18335369
potassium 4-[5-[[2-acetamido-4-(dibenzylamino)phenyl]diazenyl]-4-cyanopyrazol-1-yl]-3,5-dichlorobenzenesulfonate (PubChem CID 18335369) has the molecular formula C32H24Cl2KN7O4S and a molecular weight of 712.66 g/mol. Its IUPAC name is potassium 4-[5-[[2-acetamido-4-(dibenzylamino)phenyl]diazenyl]-4-cyanopyrazol-1-yl]-3,5-dichlorobenzenesulfonate.
| Compound Name | potassium 4-[5-[[2-acetamido-4-(dibenzylamino)phenyl]diazenyl]-4-cyanopyrazol-1-yl]-3,5-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 18335369 |
| Molecular Formula | C32H24Cl2KN7O4S |
| Molecular Weight | 712.66 g/mol |
| Exact Mass | 711.06 |
| IUPAC Name | potassium 4-[5-[[2-acetamido-4-(dibenzylamino)phenyl]diazenyl]-4-cyanopyrazol-1-yl]-3,5-dichlorobenzenesulfonate |
| SMILES | CC(=O)Nc1cc(N(Cc2ccccc2)Cc2ccccc2)ccc1/N=N/c1c(C#N)cnn1-c1c(Cl)cc(S(=O)(=O)[O-])cc1Cl.[K+] |
| InChI | InChI=1S/C32H25Cl2N7O4S.K/c1-21(42)37-30-14-25(40(19-22-8-4-2-5-9-22)20-23-10-6-3-7-11-23)12-13-29(30)38-39-32-24(17-35)18-36-41(32)31-27(33)15-26(16-28(31)34)46(43,44)45;/h2-16,18H,19-20H2,1H3,(H,37,42)(H,43,44,45);/q;+1/p-1/b39-38+; |
| InChIKey | CMQJYJSMGBJYAK-JEFPKVEISA-M |
| XLogP | 4.54 |
| TPSA | 155.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.66 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|