C26H23Cl2K2N7O6S — CID 18335387
dipotassium;1-[4-[[4-cyano-1-(2,6-dichloro-4-sulfonatophenyl)-3-methylpyrazol-5-yl]diazenyl]-3-(propanoylamino)phenyl]piperidine-3-carboxylate (PubChem CID 18335387) has the molecular formula C26H23Cl2K2N7O6S and a molecular weight of 710.68 g/mol. Its IUPAC name is dipotassium;1-[4-[[4-cyano-1-(2,6-dichloro-4-sulfonatophenyl)-3-methylpyrazol-5-yl]diazenyl]-3-(propanoylamino)phenyl]piperidine-3-carboxylate.
| Compound Name | dipotassium;1-[4-[[4-cyano-1-(2,6-dichloro-4-sulfonatophenyl)-3-methylpyrazol-5-yl]diazenyl]-3-(propanoylamino)phenyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 18335387 |
| Molecular Formula | C26H23Cl2K2N7O6S |
| Molecular Weight | 710.68 g/mol |
| Exact Mass | 709.01 |
| IUPAC Name | dipotassium;1-[4-[[4-cyano-1-(2,6-dichloro-4-sulfonatophenyl)-3-methylpyrazol-5-yl]diazenyl]-3-(propanoylamino)phenyl]piperidine-3-carboxylate |
| SMILES | CCC(=O)Nc1cc(N2CCCC(C(=O)[O-])C2)ccc1/N=N/c1c(C#N)c(C)nn1-c1c(Cl)cc(S(=O)(=O)[O-])cc1Cl.[K+].[K+] |
| InChI | InChI=1S/C26H25Cl2N7O6S.2K/c1-3-23(36)30-22-9-16(34-8-4-5-15(13-34)26(37)38)6-7-21(22)31-32-25-18(12-29)14(2)33-35(25)24-19(27)10-17(11-20(24)28)42(39,40)41;;/h6-7,9-11,15H,3-5,8,13H2,1-2H3,(H,30,36)(H,37,38)(H,39,40,41);;/q;2*+1/p-2/b32-31+;; |
| InChIKey | FNWVQSUYQFSQTA-GLDAUVFXSA-L |
| XLogP | -2.00 |
| TPSA | 196.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.68 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|