C24H21Cl2K2N7O6S — CID 18335391
dipotassium;4-[3-acetamido-4-[[4-cyano-1-(2,6-dichloro-4-sulfonatophenyl)pyrazol-5-yl]diazenyl]-N-ethylanilino]butanoate (PubChem CID 18335391) has the molecular formula C24H21Cl2K2N7O6S and a molecular weight of 684.64 g/mol. Its IUPAC name is dipotassium;4-[3-acetamido-4-[[4-cyano-1-(2,6-dichloro-4-sulfonatophenyl)pyrazol-5-yl]diazenyl]-N-ethylanilino]butanoate.
| Compound Name | dipotassium;4-[3-acetamido-4-[[4-cyano-1-(2,6-dichloro-4-sulfonatophenyl)pyrazol-5-yl]diazenyl]-N-ethylanilino]butanoate |
|---|---|
| PubChem CID | 18335391 |
| Molecular Formula | C24H21Cl2K2N7O6S |
| Molecular Weight | 684.64 g/mol |
| Exact Mass | 682.99 |
| IUPAC Name | dipotassium;4-[3-acetamido-4-[[4-cyano-1-(2,6-dichloro-4-sulfonatophenyl)pyrazol-5-yl]diazenyl]-N-ethylanilino]butanoate |
| SMILES | CCN(CCCC(=O)[O-])c1ccc(/N=N/c2c(C#N)cnn2-c2c(Cl)cc(S(=O)(=O)[O-])cc2Cl)c(NC(C)=O)c1.[K+].[K+] |
| InChI | InChI=1S/C24H23Cl2N7O6S.2K/c1-3-32(8-4-5-22(35)36)16-6-7-20(21(9-16)29-14(2)34)30-31-24-15(12-27)13-28-33(24)23-18(25)10-17(11-19(23)26)40(37,38)39;;/h6-7,9-11,13H,3-5,8H2,1-2H3,(H,29,34)(H,35,36)(H,37,38,39);;/q;2*+1/p-2/b31-30+;; |
| InChIKey | LTJDRPYRTATLIP-DGVXSHAUSA-L |
| XLogP | -2.31 |
| TPSA | 196.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.64 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|