C26H29K2N7O7S2 — CID 18335397
dipotassium;4-[5-[[2-acetamido-4-[ethyl(4-sulfonatobutyl)amino]phenyl]diazenyl]-4-cyanopyrazol-1-yl]-3,5-dimethylbenzenesulfonate (PubChem CID 18335397) has the molecular formula C26H29K2N7O7S2 and a molecular weight of 693.89 g/mol. Its IUPAC name is dipotassium;4-[5-[[2-acetamido-4-[ethyl(4-sulfonatobutyl)amino]phenyl]diazenyl]-4-cyanopyrazol-1-yl]-3,5-dimethylbenzenesulfonate.
| Compound Name | dipotassium;4-[5-[[2-acetamido-4-[ethyl(4-sulfonatobutyl)amino]phenyl]diazenyl]-4-cyanopyrazol-1-yl]-3,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 18335397 |
| Molecular Formula | C26H29K2N7O7S2 |
| Molecular Weight | 693.89 g/mol |
| Exact Mass | 693.08 |
| IUPAC Name | dipotassium;4-[5-[[2-acetamido-4-[ethyl(4-sulfonatobutyl)amino]phenyl]diazenyl]-4-cyanopyrazol-1-yl]-3,5-dimethylbenzenesulfonate |
| SMILES | CCN(CCCCS(=O)(=O)[O-])c1ccc(/N=N/c2c(C#N)cnn2-c2c(C)cc(S(=O)(=O)[O-])cc2C)c(NC(C)=O)c1.[K+].[K+] |
| InChI | InChI=1S/C26H31N7O7S2.2K/c1-5-32(10-6-7-11-41(35,36)37)21-8-9-23(24(14-21)29-19(4)34)30-31-26-20(15-27)16-28-33(26)25-17(2)12-22(13-18(25)3)42(38,39)40;;/h8-9,12-14,16H,5-7,10-11H2,1-4H3,(H,29,34)(H,35,36,37)(H,38,39,40);;/q;2*+1/p-2/b31-30+;; |
| InChIKey | XATDCUYHCCSUSK-DGVXSHAUSA-L |
| XLogP | -2.20 |
| TPSA | 213.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.89 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|