C26H26Cl3K2N7O7S2 — CID 18335409
dipotassium;4-[3-acetamido-4-[[4-cyano-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]diazenyl]-N-(4-sulfonatobutyl)anilino]butane-1-sulfonate (PubChem CID 18335409) has the molecular formula C26H26Cl3K2N7O7S2 and a molecular weight of 797.22 g/mol. Its IUPAC name is dipotassium;4-[3-acetamido-4-[[4-cyano-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]diazenyl]-N-(4-sulfonatobutyl)anilino]butane-1-sulfonate.
| Compound Name | dipotassium;4-[3-acetamido-4-[[4-cyano-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]diazenyl]-N-(4-sulfonatobutyl)anilino]butane-1-sulfonate |
|---|---|
| PubChem CID | 18335409 |
| Molecular Formula | C26H26Cl3K2N7O7S2 |
| Molecular Weight | 797.22 g/mol |
| Exact Mass | 794.97 |
| IUPAC Name | dipotassium;4-[3-acetamido-4-[[4-cyano-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]diazenyl]-N-(4-sulfonatobutyl)anilino]butane-1-sulfonate |
| SMILES | CC(=O)Nc1cc(N(CCCCS(=O)(=O)[O-])CCCCS(=O)(=O)[O-])ccc1/N=N/c1c(C#N)cnn1-c1c(Cl)cc(Cl)cc1Cl.[K+].[K+] |
| InChI | InChI=1S/C26H28Cl3N7O7S2.2K/c1-17(37)32-24-14-20(35(8-2-4-10-44(38,39)40)9-3-5-11-45(41,42)43)6-7-23(24)33-34-26-18(15-30)16-31-36(26)25-21(28)12-19(27)13-22(25)29;;/h6-7,12-14,16H,2-5,8-11H2,1H3,(H,32,37)(H,38,39,40)(H,41,42,43);;/q;2*+1/p-2/b34-33+;; |
| InChIKey | TWKCIPBYIQRLLU-ZIJRHPRESA-L |
| XLogP | -0.46 |
| TPSA | 213.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.22 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|