C26H31N7O13S4 — CID 18335448
3-[5-[[2-acetamido-4-[bis(4-sulfobutyl)amino]phenyl]diazenyl]-4-cyanopyrazol-1-yl]-4-(trioxidanylsulfanyl)benzenesulfonic acid (PubChem CID 18335448) has the molecular formula C26H31N7O13S4 and a molecular weight of 777.84 g/mol. Its IUPAC name is 3-[5-[[2-acetamido-4-[bis(4-sulfobutyl)amino]phenyl]diazenyl]-4-cyanopyrazol-1-yl]-4-(trioxidanylsulfanyl)benzenesulfonic acid.
| Compound Name | 3-[5-[[2-acetamido-4-[bis(4-sulfobutyl)amino]phenyl]diazenyl]-4-cyanopyrazol-1-yl]-4-(trioxidanylsulfanyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 18335448 |
| Molecular Formula | C26H31N7O13S4 |
| Molecular Weight | 777.84 g/mol |
| Exact Mass | 777.09 |
| IUPAC Name | 3-[5-[[2-acetamido-4-[bis(4-sulfobutyl)amino]phenyl]diazenyl]-4-cyanopyrazol-1-yl]-4-(trioxidanylsulfanyl)benzenesulfonic acid |
| SMILES | CC(=O)Nc1cc(N(CCCCS(=O)(=O)O)CCCCS(=O)(=O)O)ccc1/N=N/c1c(C#N)cnn1-c1cc(S(=O)(=O)O)ccc1SOOO |
| InChI | InChI=1S/C26H31N7O13S4/c1-18(34)29-23-14-20(32(10-2-4-12-48(36,37)38)11-3-5-13-49(39,40)41)6-8-22(23)30-31-26-19(16-27)17-28-33(26)24-15-21(50(42,43)44)7-9-25(24)47-46-45-35/h6-9,14-15,17,35H,2-5,10-13H2,1H3,(H,29,34)(H,36,37,38)(H,39,40,41)(H,42,43,44)/b31-30+ |
| InChIKey | RJQOLYKRYAPELG-NVQSTNCTSA-N |
| XLogP | 3.94 |
| TPSA | 300.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.84 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|