C36H50Cl2N8O2 — CID 18335465
N-[2-[[3-tert-butyl-4-cyano-1-[2,6-dichloro-4-(heptan-3-yloxymethylamino)phenyl]pyrazol-5-yl]diazenyl]-5-[di(propan-2-yl)amino]phenyl]acetamide (PubChem CID 18335465) has the molecular formula C36H50Cl2N8O2 and a molecular weight of 697.76 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-4-cyano-1-[2,6-dichloro-4-(heptan-3-yloxymethylamino)phenyl]pyrazol-5-yl]diazenyl]-5-[di(propan-2-yl)amino]phenyl]acetamide.
| Compound Name | N-[2-[[3-tert-butyl-4-cyano-1-[2,6-dichloro-4-(heptan-3-yloxymethylamino)phenyl]pyrazol-5-yl]diazenyl]-5-[di(propan-2-yl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 18335465 |
| Molecular Formula | C36H50Cl2N8O2 |
| Molecular Weight | 697.76 g/mol |
| Exact Mass | 696.34 |
| IUPAC Name | N-[2-[[3-tert-butyl-4-cyano-1-[2,6-dichloro-4-(heptan-3-yloxymethylamino)phenyl]pyrazol-5-yl]diazenyl]-5-[di(propan-2-yl)amino]phenyl]acetamide |
| SMILES | CCCCC(CC)OCNc1cc(Cl)c(-n2nc(C(C)(C)C)c(C#N)c2/N=N/c2ccc(N(C(C)C)C(C)C)cc2NC(C)=O)c(Cl)c1 |
| InChI | InChI=1S/C36H50Cl2N8O2/c1-11-13-14-27(12-2)48-21-40-25-17-29(37)33(30(38)18-25)46-35(28(20-39)34(44-46)36(8,9)10)43-42-31-16-15-26(19-32(31)41-24(7)47)45(22(3)4)23(5)6/h15-19,22-23,27,40H,11-14,21H2,1-10H3,(H,41,47)/b43-42+ |
| InChIKey | RBTBVFFPTHENRL-HBSCQBRPSA-N |
| XLogP | 10.70 |
| TPSA | 119.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.76 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|