C46H70Cl2N8O2 — CID 18335466
N-[2-[[3-tert-butyl-4-cyano-1-[2,6-dichloro-4-(heptan-3-yloxymethylamino)phenyl]pyrazol-5-yl]diazenyl]-5-(dioctylamino)phenyl]acetamide (PubChem CID 18335466) has the molecular formula C46H70Cl2N8O2 and a molecular weight of 838.03 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-4-cyano-1-[2,6-dichloro-4-(heptan-3-yloxymethylamino)phenyl]pyrazol-5-yl]diazenyl]-5-(dioctylamino)phenyl]acetamide.
| Compound Name | N-[2-[[3-tert-butyl-4-cyano-1-[2,6-dichloro-4-(heptan-3-yloxymethylamino)phenyl]pyrazol-5-yl]diazenyl]-5-(dioctylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 18335466 |
| Molecular Formula | C46H70Cl2N8O2 |
| Molecular Weight | 838.03 g/mol |
| Exact Mass | 836.50 |
| IUPAC Name | N-[2-[[3-tert-butyl-4-cyano-1-[2,6-dichloro-4-(heptan-3-yloxymethylamino)phenyl]pyrazol-5-yl]diazenyl]-5-(dioctylamino)phenyl]acetamide |
| SMILES | CCCCCCCCN(CCCCCCCC)c1ccc(/N=N/c2c(C#N)c(C(C)(C)C)nn2-c2c(Cl)cc(NCOC(CC)CCCC)cc2Cl)c(NC(C)=O)c1 |
| InChI | InChI=1S/C46H70Cl2N8O2/c1-9-13-16-18-20-22-27-55(28-23-21-19-17-14-10-2)36-25-26-41(42(31-36)51-34(5)57)52-53-45-38(32-49)44(46(6,7)8)54-56(45)43-39(47)29-35(30-40(43)48)50-33-58-37(12-4)24-15-11-3/h25-26,29-31,37,50H,9-24,27-28,33H2,1-8H3,(H,51,57)/b53-52+ |
| InChIKey | MFAPSGBNIHGSDR-KNPAHQFXSA-N |
| XLogP | 14.60 |
| TPSA | 119.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.03 |
| LogP ≤ 5 | 14.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|