C38H52Cl3N7O — CID 18335469
N-[2-[[3-tert-butyl-4-cyano-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]diazenyl]-5-(dioctylamino)phenyl]acetamide (PubChem CID 18335469) has the molecular formula C38H52Cl3N7O and a molecular weight of 729.24 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-4-cyano-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]diazenyl]-5-(dioctylamino)phenyl]acetamide.
| Compound Name | N-[2-[[3-tert-butyl-4-cyano-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]diazenyl]-5-(dioctylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 18335469 |
| Molecular Formula | C38H52Cl3N7O |
| Molecular Weight | 729.24 g/mol |
| Exact Mass | 727.33 |
| IUPAC Name | N-[2-[[3-tert-butyl-4-cyano-1-(2,4,6-trichlorophenyl)pyrazol-5-yl]diazenyl]-5-(dioctylamino)phenyl]acetamide |
| SMILES | CCCCCCCCN(CCCCCCCC)c1ccc(/N=N/c2c(C#N)c(C(C)(C)C)nn2-c2c(Cl)cc(Cl)cc2Cl)c(NC(C)=O)c1 |
| InChI | InChI=1S/C38H52Cl3N7O/c1-7-9-11-13-15-17-21-47(22-18-16-14-12-10-8-2)29-19-20-33(34(25-29)43-27(3)49)44-45-37-30(26-42)36(38(4,5)6)46-48(37)35-31(40)23-28(39)24-32(35)41/h19-20,23-25H,7-18,21-22H2,1-6H3,(H,43,49)/b45-44+ |
| InChIKey | VRZWCCIULLEZCH-JQOKOOLQSA-N |
| XLogP | 12.90 |
| TPSA | 98.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.24 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|