C16H27F3N4O3 — CID 18335506
1-(8,11-diacetyl-1,4,8,11-tetrazacyclotetradec-1-yl)-2,2,2-trifluoroethanone (PubChem CID 18335506) has the molecular formula C16H27F3N4O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is 1-(8,11-diacetyl-1,4,8,11-tetrazacyclotetradec-1-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(8,11-diacetyl-1,4,8,11-tetrazacyclotetradec-1-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 18335506 |
| Molecular Formula | C16H27F3N4O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 1-(8,11-diacetyl-1,4,8,11-tetrazacyclotetradec-1-yl)-2,2,2-trifluoroethanone |
| SMILES | CC(=O)N1CCCNCCN(C(=O)C(F)(F)F)CCCN(C(C)=O)CC1 |
| InChI | InChI=1S/C16H27F3N4O3/c1-13(24)21-7-3-5-20-6-10-23(15(26)16(17,18)19)9-4-8-22(12-11-21)14(2)25/h20H,3-12H2,1-2H3 |
| InChIKey | DMZDKLOGXQRTIX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |