C8H24O6Si4 — CID 18335933
2,4-dimethoxy-2,4,6,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 18335933) has the molecular formula C8H24O6Si4 and a molecular weight of 328.62 g/mol. Its IUPAC name is 2,4-dimethoxy-2,4,6,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4-dimethoxy-2,4,6,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 18335933 |
| Molecular Formula | C8H24O6Si4 |
| Molecular Weight | 328.62 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 2,4-dimethoxy-2,4,6,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CO[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(OC)O1 |
| InChI | InChI=1S/C8H24O6Si4/c1-9-17(7)12-15(3,4)11-16(5,6)13-18(8,10-2)14-17/h1-8H3 |
| InChIKey | SCESERLHSQYMDB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.62 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|