C32H61NO5 — CID 18335951
1-O-decyl 3-O-propyl 2-[7-(2,2,6,6-tetramethylpiperidin-4-yl)oxyheptyl]propanedioate (PubChem CID 18335951) has the molecular formula C32H61NO5 and a molecular weight of 539.84 g/mol. Its IUPAC name is 1-O-decyl 3-O-propyl 2-[7-(2,2,6,6-tetramethylpiperidin-4-yl)oxyheptyl]propanedioate.
| Compound Name | 1-O-decyl 3-O-propyl 2-[7-(2,2,6,6-tetramethylpiperidin-4-yl)oxyheptyl]propanedioate |
|---|---|
| PubChem CID | 18335951 |
| Molecular Formula | C32H61NO5 |
| Molecular Weight | 539.84 g/mol |
| Exact Mass | 539.45 |
| IUPAC Name | 1-O-decyl 3-O-propyl 2-[7-(2,2,6,6-tetramethylpiperidin-4-yl)oxyheptyl]propanedioate |
| SMILES | CCCCCCCCCCOC(=O)C(CCCCCCCOC1CC(C)(C)NC(C)(C)C1)C(=O)OCCC |
| InChI | InChI=1S/C32H61NO5/c1-7-9-10-11-12-13-16-20-24-38-30(35)28(29(34)37-22-8-2)21-18-15-14-17-19-23-36-27-25-31(3,4)33-32(5,6)26-27/h27-28,33H,7-26H2,1-6H3 |
| InChIKey | JQUHOHARAXXUSS-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.84 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|